C15H25NO3 — CID 68597102
2,5-dihydroxybenzamide;octane (PubChem CID 68597102) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 2,5-dihydroxybenzamide;octane.
| Compound Name | 2,5-dihydroxybenzamide;octane |
|---|---|
| PubChem CID | 68597102 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2,5-dihydroxybenzamide;octane |
| SMILES | CCCCCCCC.NC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C8H18.C7H7NO3/c1-3-5-7-8-6-4-2;8-7(11)5-3-4(9)1-2-6(5)10/h3-8H2,1-2H3;1-3,9-10H,(H2,8,11) |
| InChIKey | MVWBRSBFDHWTLH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|