About (2,5-dihydroxyphenyl)-(4,4-dimethylazepan-1-yl)methanone
(2,5-dihydroxyphenyl)-(4,4-dimethylazepan-1-yl)methanone (PubChem CID 107723207) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is (2,5-dihydroxyphenyl)-(4,4-dimethylazepan-1-yl)methanone.
Molecular Properties
| Compound Name | (2,5-dihydroxyphenyl)-(4,4-dimethylazepan-1-yl)methanone |
| PubChem CID | 107723207 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (2,5-dihydroxyphenyl)-(4,4-dimethylazepan-1-yl)methanone |
| SMILES | CC1(C)CCCN(C(=O)c2cc(O)ccc2O)CC1 |
| InChI | InChI=1S/C15H21NO3/c1-15(2)6-3-8-16(9-7-15)14(19)12-10-11(17)4-5-13(12)18/h4-5,10,17-18H,3,6-9H2,1-2H3 |
| InChIKey | WSSTZBPFEWDCEK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dihydroxyphenyl)-(4,4-dimethylazepan-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxyphenyl)-(4,4-dimethylazepan-1-yl)methanone?
The IUPAC name of (2,5-dihydroxyphenyl)-(4,4-dimethylazepan-1-yl)methanone (CID 107723207) is (2,5-dihydroxyphenyl)-(4,4-dimethylazepan-1-yl)methanone.
What is the SMILES notation for (2,5-dihydroxyphenyl)-(4,4-dimethylazepan-1-yl)methanone?
The canonical SMILES for (2,5-dihydroxyphenyl)-(4,4-dimethylazepan-1-yl)methanone is CC1(C)CCCN(C(=O)c2cc(O)ccc2O)CC1.
What is the InChIKey of (2,5-dihydroxyphenyl)-(4,4-dimethylazepan-1-yl)methanone?
The InChIKey is WSSTZBPFEWDCEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-15(2)6-3-8-16(9-7-15)14(19)12-10-11(17)4-5-13(12)18/h4-5,10,17-18H,3,6-9H2,1-2H3.
What are the key properties of (2,5-dihydroxyphenyl)-(4,4-dimethylazepan-1-yl)methanone?
(2,5-dihydroxyphenyl)-(4,4-dimethylazepan-1-yl)methanone has a molecular weight of 263.34 g/mol, XLogP of 2.75, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxyphenyl)-(4,4-dimethylazepan-1-yl)methanone is sourced from PubChem (CID 107723207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).