C15H21NO4 — CID 107723950
(2,5-dihydroxyphenyl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone (PubChem CID 107723950) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is (2,5-dihydroxyphenyl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone.
| Compound Name | (2,5-dihydroxyphenyl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 107723950 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (2,5-dihydroxyphenyl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone |
| SMILES | CC1(C)CN(C(=O)c2cc(O)ccc2O)CC(C)(C)O1 |
| InChI | InChI=1S/C15H21NO4/c1-14(2)8-16(9-15(3,4)20-14)13(19)11-7-10(17)5-6-12(11)18/h5-7,17-18H,8-9H2,1-4H3 |
| InChIKey | DYERVFHIBOWBIT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|