C14H18N2O4 — CID 102741873
(3,3-dimethylpiperidin-1-yl)-(5-hydroxy-2-nitrophenyl)methanone (PubChem CID 102741873) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (3,3-dimethylpiperidin-1-yl)-(5-hydroxy-2-nitrophenyl)methanone.
| Compound Name | (3,3-dimethylpiperidin-1-yl)-(5-hydroxy-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 102741873 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (3,3-dimethylpiperidin-1-yl)-(5-hydroxy-2-nitrophenyl)methanone |
| SMILES | CC1(C)CCCN(C(=O)c2cc(O)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C14H18N2O4/c1-14(2)6-3-7-15(9-14)13(18)11-8-10(17)4-5-12(11)16(19)20/h4-5,8,17H,3,6-7,9H2,1-2H3 |
| InChIKey | YJKXCHMXWSNXIV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|