C14H20N4O3 — CID 115937192
(3,3-dimethylpiperidin-1-yl)-(2-hydrazinyl-3-nitrophenyl)methanone (PubChem CID 115937192) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is (3,3-dimethylpiperidin-1-yl)-(2-hydrazinyl-3-nitrophenyl)methanone.
| Compound Name | (3,3-dimethylpiperidin-1-yl)-(2-hydrazinyl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 115937192 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (3,3-dimethylpiperidin-1-yl)-(2-hydrazinyl-3-nitrophenyl)methanone |
| SMILES | CC1(C)CCCN(C(=O)c2cccc([N+](=O)[O-])c2NN)C1 |
| InChI | InChI=1S/C14H20N4O3/c1-14(2)7-4-8-17(9-14)13(19)10-5-3-6-11(18(20)21)12(10)16-15/h3,5-6,16H,4,7-9,15H2,1-2H3 |
| InChIKey | MAKIZEDZSCTIEZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|