C11H14N4O4S — CID 115937034
(2-hydrazinyl-3-nitrophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone (PubChem CID 115937034) has the molecular formula C11H14N4O4S and a molecular weight of 298.32 g/mol. Its IUPAC name is (2-hydrazinyl-3-nitrophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | (2-hydrazinyl-3-nitrophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 115937034 |
| Molecular Formula | C11H14N4O4S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (2-hydrazinyl-3-nitrophenyl)-(1-oxo-1,4-thiazinan-4-yl)methanone |
| SMILES | NNc1c(C(=O)N2CCS(=O)CC2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N4O4S/c12-13-10-8(2-1-3-9(10)15(17)18)11(16)14-4-6-20(19)7-5-14/h1-3,13H,4-7,12H2 |
| InChIKey | MXTJBMDHYSAXFD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|