C13H13FN2O6 — CID 119258913
3-fluoro-1-(5-methoxy-2-nitrobenzoyl)pyrrolidine-3-carboxylic acid (PubChem CID 119258913) has the molecular formula C13H13FN2O6 and a molecular weight of 312.25 g/mol. Its IUPAC name is 3-fluoro-1-(5-methoxy-2-nitrobenzoyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-fluoro-1-(5-methoxy-2-nitrobenzoyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119258913 |
| Molecular Formula | C13H13FN2O6 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 3-fluoro-1-(5-methoxy-2-nitrobenzoyl)pyrrolidine-3-carboxylic acid |
| SMILES | COc1ccc([N+](=O)[O-])c(C(=O)N2CCC(F)(C(=O)O)C2)c1 |
| InChI | InChI=1S/C13H13FN2O6/c1-22-8-2-3-10(16(20)21)9(6-8)11(17)15-5-4-13(14,7-15)12(18)19/h2-3,6H,4-5,7H2,1H3,(H,18,19) |
| InChIKey | ZIVLQYAGIJOJOE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|