C26H29N3O8 — CID 3672768
methyl 2-[8-(2,5-dimethoxybenzoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]-6-nitrobenzoate (PubChem CID 3672768) has the molecular formula C26H29N3O8 and a molecular weight of 511.53 g/mol. Its IUPAC name is methyl 2-[8-(2,5-dimethoxybenzoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]-6-nitrobenzoate.
| Compound Name | methyl 2-[8-(2,5-dimethoxybenzoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]-6-nitrobenzoate |
|---|---|
| PubChem CID | 3672768 |
| Molecular Formula | C26H29N3O8 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | methyl 2-[8-(2,5-dimethoxybenzoyl)-2,8-diazaspiro[4.5]decane-2-carbonyl]-6-nitrobenzoate |
| SMILES | COC(=O)c1c(C(=O)N2CCC3(CCN(C(=O)c4cc(OC)ccc4OC)CC3)C2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H29N3O8/c1-35-17-7-8-21(36-2)19(15-17)24(31)27-12-9-26(10-13-27)11-14-28(16-26)23(30)18-5-4-6-20(29(33)34)22(18)25(32)37-3/h4-8,15H,9-14,16H2,1-3H3 |
| InChIKey | BRNVCKAXVRMRMN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 128.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|