C22H26N4O5S2 — CID 3863313
2-(4-methoxy-5-nitrothiophene-3-carbonyl)-N-(3-methoxyphenyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide (PubChem CID 3863313) has the molecular formula C22H26N4O5S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 2-(4-methoxy-5-nitrothiophene-3-carbonyl)-N-(3-methoxyphenyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide.
| Compound Name | 2-(4-methoxy-5-nitrothiophene-3-carbonyl)-N-(3-methoxyphenyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide |
|---|---|
| PubChem CID | 3863313 |
| Molecular Formula | C22H26N4O5S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 2-(4-methoxy-5-nitrothiophene-3-carbonyl)-N-(3-methoxyphenyl)-2,8-diazaspiro[4.5]decane-8-carbothioamide |
| SMILES | COc1cccc(NC(=S)N2CCC3(CCN(C(=O)c4csc([N+](=O)[O-])c4OC)C3)CC2)c1 |
| InChI | InChI=1S/C22H26N4O5S2/c1-30-16-5-3-4-15(12-16)23-21(32)24-9-6-22(7-10-24)8-11-25(14-22)19(27)17-13-33-20(26(28)29)18(17)31-2/h3-5,12-13H,6-11,14H2,1-2H3,(H,23,32) |
| InChIKey | ILNCWHOAHMXBAX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|