C24H39N5OS2 — CID 3862265
2-N-[3-(diethylamino)propyl]-8-N-(3-methoxyphenyl)-2,8-diazaspiro[4.5]decane-2,8-dicarbothioamide (PubChem CID 3862265) has the molecular formula C24H39N5OS2 and a molecular weight of 477.74 g/mol. Its IUPAC name is 2-N-[3-(diethylamino)propyl]-8-N-(3-methoxyphenyl)-2,8-diazaspiro[4.5]decane-2,8-dicarbothioamide.
| Compound Name | 2-N-[3-(diethylamino)propyl]-8-N-(3-methoxyphenyl)-2,8-diazaspiro[4.5]decane-2,8-dicarbothioamide |
|---|---|
| PubChem CID | 3862265 |
| Molecular Formula | C24H39N5OS2 |
| Molecular Weight | 477.74 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 2-N-[3-(diethylamino)propyl]-8-N-(3-methoxyphenyl)-2,8-diazaspiro[4.5]decane-2,8-dicarbothioamide |
| SMILES | CCN(CC)CCCNC(=S)N1CCC2(CCN(C(=S)Nc3cccc(OC)c3)CC2)C1 |
| InChI | InChI=1S/C24H39N5OS2/c1-4-27(5-2)14-7-13-25-22(31)29-17-12-24(19-29)10-15-28(16-11-24)23(32)26-20-8-6-9-21(18-20)30-3/h6,8-9,18H,4-5,7,10-17,19H2,1-3H3,(H,25,31)(H,26,32) |
| InChIKey | HQJDYODZSLMGFQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 43.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.74 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|