C23H32N4O5S — CID 74225280
methyl (2S)-2-acetamido-4-[8-[(3-methoxyphenyl)carbamothioyl]-2,8-diazaspiro[4.5]decan-2-yl]-4-oxobutanoate (PubChem CID 74225280) has the molecular formula C23H32N4O5S and a molecular weight of 476.60 g/mol. Its IUPAC name is methyl (2S)-2-acetamido-4-[8-[(3-methoxyphenyl)carbamothioyl]-2,8-diazaspiro[4.5]decan-2-yl]-4-oxobutanoate.
| Compound Name | methyl (2S)-2-acetamido-4-[8-[(3-methoxyphenyl)carbamothioyl]-2,8-diazaspiro[4.5]decan-2-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 74225280 |
| Molecular Formula | C23H32N4O5S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | methyl (2S)-2-acetamido-4-[8-[(3-methoxyphenyl)carbamothioyl]-2,8-diazaspiro[4.5]decan-2-yl]-4-oxobutanoate |
| SMILES | COC(=O)[C@H](CC(=O)N1CCC2(CCN(C(=S)Nc3cccc(OC)c3)CC2)C1)NC(C)=O |
| InChI | InChI=1S/C23H32N4O5S/c1-16(28)24-19(21(30)32-3)14-20(29)27-12-9-23(15-27)7-10-26(11-8-23)22(33)25-17-5-4-6-18(13-17)31-2/h4-6,13,19H,7-12,14-15H2,1-3H3,(H,24,28)(H,25,33)/t19-/m0/s1 |
| InChIKey | ZSHZHTWKQFMCMS-IBGZPJMESA-N |
| XLogP | 1.77 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|