C26H33N3O5S — CID 3548836
8-(2,5-dimethoxybenzoyl)-N-(3,5-dimethoxyphenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide (PubChem CID 3548836) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is 8-(2,5-dimethoxybenzoyl)-N-(3,5-dimethoxyphenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide.
| Compound Name | 8-(2,5-dimethoxybenzoyl)-N-(3,5-dimethoxyphenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
|---|---|
| PubChem CID | 3548836 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 8-(2,5-dimethoxybenzoyl)-N-(3,5-dimethoxyphenyl)-2,8-diazaspiro[4.5]decane-2-carbothioamide |
| SMILES | COc1cc(NC(=S)N2CCC3(CCN(C(=O)c4cc(OC)ccc4OC)CC3)C2)cc(OC)c1 |
| InChI | InChI=1S/C26H33N3O5S/c1-31-19-5-6-23(34-4)22(16-19)24(30)28-10-7-26(8-11-28)9-12-29(17-26)25(35)27-18-13-20(32-2)15-21(14-18)33-3/h5-6,13-16H,7-12,17H2,1-4H3,(H,27,35) |
| InChIKey | LNLULVAUYOFRHF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|