C16H25N4O2S+ — CID 9217793
2-[4-[(3-methoxyphenyl)carbamothioyl]piperazin-1-ium-1-yl]-N,N-dimethylacetamide (PubChem CID 9217793) has the molecular formula C16H25N4O2S+ and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-[4-[(3-methoxyphenyl)carbamothioyl]piperazin-1-ium-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[(3-methoxyphenyl)carbamothioyl]piperazin-1-ium-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 9217793 |
| Molecular Formula | C16H25N4O2S+ |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-[4-[(3-methoxyphenyl)carbamothioyl]piperazin-1-ium-1-yl]-N,N-dimethylacetamide |
| SMILES | COc1cccc(NC(=S)N2CC[NH+](CC(=O)N(C)C)CC2)c1 |
| InChI | InChI=1S/C16H24N4O2S/c1-18(2)15(21)12-19-7-9-20(10-8-19)16(23)17-13-5-4-6-14(11-13)22-3/h4-6,11H,7-10,12H2,1-3H3,(H,17,23)/p+1 |
| InChIKey | FWGCEXHLJOYUKN-UHFFFAOYSA-O |
| XLogP | -0.32 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|