C19H23FN3OS+ — CID 4095866
3-[(4-fluorophenyl)methyl]-N-(3-methoxyphenyl)-1,3-diazinan-3-ium-1-carbothioamide (PubChem CID 4095866) has the molecular formula C19H23FN3OS+ and a molecular weight of 360.48 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-N-(3-methoxyphenyl)-1,3-diazinan-3-ium-1-carbothioamide.
| Compound Name | 3-[(4-fluorophenyl)methyl]-N-(3-methoxyphenyl)-1,3-diazinan-3-ium-1-carbothioamide |
|---|---|
| PubChem CID | 4095866 |
| Molecular Formula | C19H23FN3OS+ |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-N-(3-methoxyphenyl)-1,3-diazinan-3-ium-1-carbothioamide |
| SMILES | COc1cccc(NC(=S)N2CCC[NH+](Cc3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C19H22FN3OS/c1-24-18-5-2-4-17(12-18)21-19(25)23-11-3-10-22(14-23)13-15-6-8-16(20)9-7-15/h2,4-9,12H,3,10-11,13-14H2,1H3,(H,21,25)/p+1 |
| InChIKey | CVPTVBGYYWRXAP-UHFFFAOYSA-O |
| XLogP | 2.28 |
| TPSA | 28.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|