C26H31N3O2+2 — CID 7480755
4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-N-(3-methoxyphenyl)benzamide (PubChem CID 7480755) has the molecular formula C26H31N3O2+2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-N-(3-methoxyphenyl)benzamide.
| Compound Name | 4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-N-(3-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 7480755 |
| Molecular Formula | C26H31N3O2+2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 4-[(4-benzylpiperazine-1,4-diium-1-yl)methyl]-N-(3-methoxyphenyl)benzamide |
| SMILES | COc1cccc(NC(=O)c2ccc(C[NH+]3CC[NH+](Cc4ccccc4)CC3)cc2)c1 |
| InChI | InChI=1S/C26H29N3O2/c1-31-25-9-5-8-24(18-25)27-26(30)23-12-10-22(11-13-23)20-29-16-14-28(15-17-29)19-21-6-3-2-4-7-21/h2-13,18H,14-17,19-20H2,1H3,(H,27,30)/p+2 |
| InChIKey | LPKHVAZVSHKFOO-UHFFFAOYSA-P |
| XLogP | 1.43 |
| TPSA | 47.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |