C20H19N3O2 — CID 109231885
5-(benzylamino)-N-(3-methoxyphenyl)pyridine-3-carboxamide (PubChem CID 109231885) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 5-(benzylamino)-N-(3-methoxyphenyl)pyridine-3-carboxamide.
| Compound Name | 5-(benzylamino)-N-(3-methoxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109231885 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 5-(benzylamino)-N-(3-methoxyphenyl)pyridine-3-carboxamide |
| SMILES | COc1cccc(NC(=O)c2cncc(NCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C20H19N3O2/c1-25-19-9-5-8-17(11-19)23-20(24)16-10-18(14-21-13-16)22-12-15-6-3-2-4-7-15/h2-11,13-14,22H,12H2,1H3,(H,23,24) |
| InChIKey | IXSQJQLCIRDEAW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |