C20H24N3O3+ — CID 7393123
N-(3-acetamidophenyl)-4-(morpholin-4-ium-4-ylmethyl)benzamide (PubChem CID 7393123) has the molecular formula C20H24N3O3+ and a molecular weight of 354.43 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-4-(morpholin-4-ium-4-ylmethyl)benzamide.
| Compound Name | N-(3-acetamidophenyl)-4-(morpholin-4-ium-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 7393123 |
| Molecular Formula | C20H24N3O3+ |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-(3-acetamidophenyl)-4-(morpholin-4-ium-4-ylmethyl)benzamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)c2ccc(C[NH+]3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C20H23N3O3/c1-15(24)21-18-3-2-4-19(13-18)22-20(25)17-7-5-16(6-8-17)14-23-9-11-26-12-10-23/h2-8,13H,9-12,14H2,1H3,(H,21,24)(H,22,25)/p+1 |
| InChIKey | ATMKROICGLKZTC-UHFFFAOYSA-O |
| XLogP | 1.31 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |