C22H29N2O2+ — CID 2205983
N-(2-methyl-6-propan-2-ylphenyl)-4-(morpholin-4-ium-4-ylmethyl)benzamide (PubChem CID 2205983) has the molecular formula C22H29N2O2+ and a molecular weight of 353.49 g/mol. Its IUPAC name is N-(2-methyl-6-propan-2-ylphenyl)-4-(morpholin-4-ium-4-ylmethyl)benzamide.
| Compound Name | N-(2-methyl-6-propan-2-ylphenyl)-4-(morpholin-4-ium-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 2205983 |
| Molecular Formula | C22H29N2O2+ |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | N-(2-methyl-6-propan-2-ylphenyl)-4-(morpholin-4-ium-4-ylmethyl)benzamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)c1ccc(C[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C22H28N2O2/c1-16(2)20-6-4-5-17(3)21(20)23-22(25)19-9-7-18(8-10-19)15-24-11-13-26-14-12-24/h4-10,16H,11-15H2,1-3H3,(H,23,25)/p+1 |
| InChIKey | QPMAUONRRSIOJN-UHFFFAOYSA-O |
| XLogP | 2.79 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |