C23H29N2O4+ — CID 7768834
[2-(2-ethyl-6-methylanilino)-2-oxoethyl] 4-(morpholin-4-ium-4-ylmethyl)benzoate (PubChem CID 7768834) has the molecular formula C23H29N2O4+ and a molecular weight of 397.50 g/mol. Its IUPAC name is [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 4-(morpholin-4-ium-4-ylmethyl)benzoate.
| Compound Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 4-(morpholin-4-ium-4-ylmethyl)benzoate |
|---|---|
| PubChem CID | 7768834 |
| Molecular Formula | C23H29N2O4+ |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | [2-(2-ethyl-6-methylanilino)-2-oxoethyl] 4-(morpholin-4-ium-4-ylmethyl)benzoate |
| SMILES | CCc1cccc(C)c1NC(=O)COC(=O)c1ccc(C[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-3-19-6-4-5-17(2)22(19)24-21(26)16-29-23(27)20-9-7-18(8-10-20)15-25-11-13-28-14-12-25/h4-10H,3,11-16H2,1-2H3,(H,24,26)/p+1 |
| InChIKey | KXRJCEVSRNAMGF-UHFFFAOYSA-O |
| XLogP | 1.77 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |