C21H31N2O4+ — CID 7768939
[2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 4-(morpholin-4-ium-4-ylmethyl)benzoate (PubChem CID 7768939) has the molecular formula C21H31N2O4+ and a molecular weight of 375.49 g/mol. Its IUPAC name is [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 4-(morpholin-4-ium-4-ylmethyl)benzoate.
| Compound Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 4-(morpholin-4-ium-4-ylmethyl)benzoate |
|---|---|
| PubChem CID | 7768939 |
| Molecular Formula | C21H31N2O4+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 4-(morpholin-4-ium-4-ylmethyl)benzoate |
| SMILES | CC1CCC(NC(=O)COC(=O)c2ccc(C[NH+]3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C21H30N2O4/c1-16-2-8-19(9-3-16)22-20(24)15-27-21(25)18-6-4-17(5-7-18)14-23-10-12-26-13-11-23/h4-7,16,19H,2-3,8-15H2,1H3,(H,22,24)/p+1 |
| InChIKey | UQBKICBDJLGVAX-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |