C20H29N2O4+ — CID 7768923
[(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-(morpholin-4-ium-4-ylmethyl)benzoate (PubChem CID 7768923) has the molecular formula C20H29N2O4+ and a molecular weight of 361.46 g/mol. Its IUPAC name is [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-(morpholin-4-ium-4-ylmethyl)benzoate.
| Compound Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-(morpholin-4-ium-4-ylmethyl)benzoate |
|---|---|
| PubChem CID | 7768923 |
| Molecular Formula | C20H29N2O4+ |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | [(2R)-1-(cyclopentylamino)-1-oxopropan-2-yl] 4-(morpholin-4-ium-4-ylmethyl)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(C[NH+]2CCOCC2)cc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H28N2O4/c1-15(19(23)21-18-4-2-3-5-18)26-20(24)17-8-6-16(7-9-17)14-22-10-12-25-13-11-22/h6-9,15,18H,2-5,10-14H2,1H3,(H,21,23)/p+1/t15-/m1/s1 |
| InChIKey | ZUVJGKMIUHGOGS-OAHLLOKOSA-O |
| XLogP | 0.71 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |