C21H24ClN2O4+ — CID 7768557
[(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 4-(morpholin-4-ium-4-ylmethyl)benzoate (PubChem CID 7768557) has the molecular formula C21H24ClN2O4+ and a molecular weight of 403.89 g/mol. Its IUPAC name is [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 4-(morpholin-4-ium-4-ylmethyl)benzoate.
| Compound Name | [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 4-(morpholin-4-ium-4-ylmethyl)benzoate |
|---|---|
| PubChem CID | 7768557 |
| Molecular Formula | C21H24ClN2O4+ |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 4-(morpholin-4-ium-4-ylmethyl)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(C[NH+]2CCOCC2)cc1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H23ClN2O4/c1-15(20(25)23-19-4-2-3-18(22)13-19)28-21(26)17-7-5-16(6-8-17)14-24-9-11-27-12-10-24/h2-8,13,15H,9-12,14H2,1H3,(H,23,25)/p+1/t15-/m1/s1 |
| InChIKey | KTJPFCBNENMIME-OAHLLOKOSA-O |
| XLogP | 1.94 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |