C18H24N3O5+ — CID 7768496
[2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-(morpholin-4-ium-4-ylmethyl)benzoate (PubChem CID 7768496) has the molecular formula C18H24N3O5+ and a molecular weight of 362.41 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-(morpholin-4-ium-4-ylmethyl)benzoate.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-(morpholin-4-ium-4-ylmethyl)benzoate |
|---|---|
| PubChem CID | 7768496 |
| Molecular Formula | C18H24N3O5+ |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-(morpholin-4-ium-4-ylmethyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(C[NH+]2CCOCC2)cc1)NC(=O)NC1CC1 |
| InChI | InChI=1S/C18H23N3O5/c22-16(20-18(24)19-15-5-6-15)12-26-17(23)14-3-1-13(2-4-14)11-21-7-9-25-10-8-21/h1-4,15H,5-12H2,(H2,19,20,22,24)/p+1 |
| InChIKey | GCXOVBMFKVDRAT-UHFFFAOYSA-O |
| XLogP | -0.75 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |