C20H19ClN2O4S — CID 8815839
[2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate (PubChem CID 8815839) has the molecular formula C20H19ClN2O4S and a molecular weight of 418.90 g/mol. Its IUPAC name is [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate.
| Compound Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 8815839 |
| Molecular Formula | C20H19ClN2O4S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [2-(cyclopropylcarbamoylamino)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(CSc2ccc(Cl)cc2)cc1)NC(=O)NC1CC1 |
| InChI | InChI=1S/C20H19ClN2O4S/c21-15-5-9-17(10-6-15)28-12-13-1-3-14(4-2-13)19(25)27-11-18(24)23-20(26)22-16-7-8-16/h1-6,9-10,16H,7-8,11-12H2,(H2,22,23,24,26) |
| InChIKey | XUDPEMXIXFCRMM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |