C26H27ClO3S — CID 3345275
[2-(1-adamantyl)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate (PubChem CID 3345275) has the molecular formula C26H27ClO3S and a molecular weight of 455.02 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 3345275 |
| Molecular Formula | C26H27ClO3S |
| Molecular Weight | 455.02 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate |
| SMILES | O=C(OCC(=O)C12CC3CC(CC(C3)C1)C2)c1ccc(CSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H27ClO3S/c27-22-5-7-23(8-6-22)31-16-17-1-3-21(4-2-17)25(29)30-15-24(28)26-12-18-9-19(13-26)11-20(10-18)14-26/h1-8,18-20H,9-16H2 |
| InChIKey | AOSCVDYFUIADHE-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.02 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |