C20H22ClNO3S — CID 2416355
[2-(butylamino)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate (PubChem CID 2416355) has the molecular formula C20H22ClNO3S and a molecular weight of 391.92 g/mol. Its IUPAC name is [2-(butylamino)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate.
| Compound Name | [2-(butylamino)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 2416355 |
| Molecular Formula | C20H22ClNO3S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [2-(butylamino)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate |
| SMILES | CCCCNC(=O)COC(=O)c1ccc(CSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H22ClNO3S/c1-2-3-12-22-19(23)13-25-20(24)16-6-4-15(5-7-16)14-26-18-10-8-17(21)9-11-18/h4-11H,2-3,12-14H2,1H3,(H,22,23) |
| InChIKey | UVNPKKFELMJLHQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|