C21H24ClNO3S — CID 7841095
[2-(3-methylbutylamino)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate (PubChem CID 7841095) has the molecular formula C21H24ClNO3S and a molecular weight of 405.95 g/mol. Its IUPAC name is [2-(3-methylbutylamino)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate.
| Compound Name | [2-(3-methylbutylamino)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 7841095 |
| Molecular Formula | C21H24ClNO3S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | [2-(3-methylbutylamino)-2-oxoethyl] 4-[(4-chlorophenyl)sulfanylmethyl]benzoate |
| SMILES | CC(C)CCNC(=O)COC(=O)c1ccc(CSc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H24ClNO3S/c1-15(2)11-12-23-20(24)13-26-21(25)17-5-3-16(4-6-17)14-27-19-9-7-18(22)8-10-19/h3-10,15H,11-14H2,1-2H3,(H,23,24) |
| InChIKey | HUILCFWLSOIUKA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |