C14H17ClFNO3 — CID 46859585
[2-(3-methylbutylamino)-2-oxoethyl] 3-chloro-4-fluorobenzoate (PubChem CID 46859585) has the molecular formula C14H17ClFNO3 and a molecular weight of 301.75 g/mol. Its IUPAC name is [2-(3-methylbutylamino)-2-oxoethyl] 3-chloro-4-fluorobenzoate.
| Compound Name | [2-(3-methylbutylamino)-2-oxoethyl] 3-chloro-4-fluorobenzoate |
|---|---|
| PubChem CID | 46859585 |
| Molecular Formula | C14H17ClFNO3 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | [2-(3-methylbutylamino)-2-oxoethyl] 3-chloro-4-fluorobenzoate |
| SMILES | CC(C)CCNC(=O)COC(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClFNO3/c1-9(2)5-6-17-13(18)8-20-14(19)10-3-4-12(16)11(15)7-10/h3-4,7,9H,5-6,8H2,1-2H3,(H,17,18) |
| InChIKey | SCSJRPFHWKEWCO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |