C15H21FN2O3 — CID 61487126
[2-(3-methylbutylamino)-2-oxoethyl] 3-amino-5-fluoro-4-methylbenzoate (PubChem CID 61487126) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is [2-(3-methylbutylamino)-2-oxoethyl] 3-amino-5-fluoro-4-methylbenzoate.
| Compound Name | [2-(3-methylbutylamino)-2-oxoethyl] 3-amino-5-fluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 61487126 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [2-(3-methylbutylamino)-2-oxoethyl] 3-amino-5-fluoro-4-methylbenzoate |
| SMILES | Cc1c(N)cc(C(=O)OCC(=O)NCCC(C)C)cc1F |
| InChI | InChI=1S/C15H21FN2O3/c1-9(2)4-5-18-14(19)8-21-15(20)11-6-12(16)10(3)13(17)7-11/h6-7,9H,4-5,8,17H2,1-3H3,(H,18,19) |
| InChIKey | WQKWZPNUEUKLLH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|