C14H19FN2O4 — CID 61487142
[2-(3-methoxypropylamino)-2-oxoethyl] 3-amino-5-fluoro-4-methylbenzoate (PubChem CID 61487142) has the molecular formula C14H19FN2O4 and a molecular weight of 298.31 g/mol. Its IUPAC name is [2-(3-methoxypropylamino)-2-oxoethyl] 3-amino-5-fluoro-4-methylbenzoate.
| Compound Name | [2-(3-methoxypropylamino)-2-oxoethyl] 3-amino-5-fluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 61487142 |
| Molecular Formula | C14H19FN2O4 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | [2-(3-methoxypropylamino)-2-oxoethyl] 3-amino-5-fluoro-4-methylbenzoate |
| SMILES | COCCCNC(=O)COC(=O)c1cc(N)c(C)c(F)c1 |
| InChI | InChI=1S/C14H19FN2O4/c1-9-11(15)6-10(7-12(9)16)14(19)21-8-13(18)17-4-3-5-20-2/h6-7H,3-5,8,16H2,1-2H3,(H,17,18) |
| InChIKey | LEGNOLYIXVMMSB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|