C16H20Cl2N2O4 — CID 7880742
[2-(3-methylbutylamino)-2-oxoethyl] 2-[(3,4-dichlorobenzoyl)amino]acetate (PubChem CID 7880742) has the molecular formula C16H20Cl2N2O4 and a molecular weight of 375.25 g/mol. Its IUPAC name is [2-(3-methylbutylamino)-2-oxoethyl] 2-[(3,4-dichlorobenzoyl)amino]acetate.
| Compound Name | [2-(3-methylbutylamino)-2-oxoethyl] 2-[(3,4-dichlorobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7880742 |
| Molecular Formula | C16H20Cl2N2O4 |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | [2-(3-methylbutylamino)-2-oxoethyl] 2-[(3,4-dichlorobenzoyl)amino]acetate |
| SMILES | CC(C)CCNC(=O)COC(=O)CNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H20Cl2N2O4/c1-10(2)5-6-19-14(21)9-24-15(22)8-20-16(23)11-3-4-12(17)13(18)7-11/h3-4,7,10H,5-6,8-9H2,1-2H3,(H,19,21)(H,20,23) |
| InChIKey | URZBQBZQBVZTGW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |