C22H23N2O2+ — CID 6949963
N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]naphthalene-2-carboxamide (PubChem CID 6949963) has the molecular formula C22H23N2O2+ and a molecular weight of 347.44 g/mol. Its IUPAC name is N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 6949963 |
| Molecular Formula | C22H23N2O2+ |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]naphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccc(C[NH+]2CCOCC2)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H22N2O2/c25-22(20-8-7-18-3-1-2-4-19(18)15-20)23-21-9-5-17(6-10-21)16-24-11-13-26-14-12-24/h1-10,15H,11-14,16H2,(H,23,25)/p+1 |
| InChIKey | SFGXIWSQLBGLGE-UHFFFAOYSA-O |
| XLogP | 2.51 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |