C21H24N3O2+ — CID 7327969
1-methyl-N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]indole-2-carboxamide (PubChem CID 7327969) has the molecular formula C21H24N3O2+ and a molecular weight of 350.44 g/mol. Its IUPAC name is 1-methyl-N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]indole-2-carboxamide.
| Compound Name | 1-methyl-N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 7327969 |
| Molecular Formula | C21H24N3O2+ |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 1-methyl-N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]indole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccc(C[NH+]3CCOCC3)cc2)cc2ccccc21 |
| InChI | InChI=1S/C21H23N3O2/c1-23-19-5-3-2-4-17(19)14-20(23)21(25)22-18-8-6-16(7-9-18)15-24-10-12-26-13-11-24/h2-9,14H,10-13,15H2,1H3,(H,22,25)/p+1 |
| InChIKey | BAWGCVLZNVQHNY-UHFFFAOYSA-O |
| XLogP | 1.85 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |