C13H12N4O — CID 166206735
1-methyl-N-(1H-pyrazol-4-yl)indole-2-carboxamide (PubChem CID 166206735) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is 1-methyl-N-(1H-pyrazol-4-yl)indole-2-carboxamide.
| Compound Name | 1-methyl-N-(1H-pyrazol-4-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 166206735 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-methyl-N-(1H-pyrazol-4-yl)indole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2cn[nH]c2)cc2ccccc21 |
| InChI | InChI=1S/C13H12N4O/c1-17-11-5-3-2-4-9(11)6-12(17)13(18)16-10-7-14-15-8-10/h2-8H,1H3,(H,14,15)(H,16,18) |
| InChIKey | HPVVJIZEDLOPQL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |