C17H13N3OS — CID 52694546
N-(1,3-benzothiazol-2-yl)-1-methylindole-2-carboxamide (PubChem CID 52694546) has the molecular formula C17H13N3OS and a molecular weight of 307.38 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-1-methylindole-2-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 52694546 |
| Molecular Formula | C17H13N3OS |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2nc3ccccc3s2)cc2ccccc21 |
| InChI | InChI=1S/C17H13N3OS/c1-20-13-8-4-2-6-11(13)10-14(20)16(21)19-17-18-12-7-3-5-9-15(12)22-17/h2-10H,1H3,(H,18,19,21) |
| InChIKey | HGIUZRLKCZYICR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |