C25H21ClN2O4 — CID 70985142
2-[3-chloro-4-[2-methyl-4-[(1-methylindole-2-carbonyl)amino]phenoxy]phenyl]acetic acid (PubChem CID 70985142) has the molecular formula C25H21ClN2O4 and a molecular weight of 448.91 g/mol. Its IUPAC name is 2-[3-chloro-4-[2-methyl-4-[(1-methylindole-2-carbonyl)amino]phenoxy]phenyl]acetic acid.
| Compound Name | 2-[3-chloro-4-[2-methyl-4-[(1-methylindole-2-carbonyl)amino]phenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 70985142 |
| Molecular Formula | C25H21ClN2O4 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-[3-chloro-4-[2-methyl-4-[(1-methylindole-2-carbonyl)amino]phenoxy]phenyl]acetic acid |
| SMILES | Cc1cc(NC(=O)c2cc3ccccc3n2C)ccc1Oc1ccc(CC(=O)O)cc1Cl |
| InChI | InChI=1S/C25H21ClN2O4/c1-15-11-18(27-25(31)21-14-17-5-3-4-6-20(17)28(21)2)8-10-22(15)32-23-9-7-16(12-19(23)26)13-24(29)30/h3-12,14H,13H2,1-2H3,(H,27,31)(H,29,30) |
| InChIKey | QZSSUWWXEKWEHZ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |