C26H26N6O2 — CID 55873164
1-methyl-N-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]phenyl]indole-2-carboxamide (PubChem CID 55873164) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 1-methyl-N-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]phenyl]indole-2-carboxamide.
| Compound Name | 1-methyl-N-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]phenyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 55873164 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 1-methyl-N-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]phenyl]indole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccc(CC(=O)N3CCN(c4ncccn4)CC3)cc2)cc2ccccc21 |
| InChI | InChI=1S/C26H26N6O2/c1-30-22-6-3-2-5-20(22)18-23(30)25(34)29-21-9-7-19(8-10-21)17-24(33)31-13-15-32(16-14-31)26-27-11-4-12-28-26/h2-12,18H,13-17H2,1H3,(H,29,34) |
| InChIKey | BWKDKTPRSRDJKO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |