C26H24N6O2S — CID 55672885
(E)-3-(1,3-benzothiazol-2-yl)-N-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]phenyl]prop-2-enamide (PubChem CID 55672885) has the molecular formula C26H24N6O2S and a molecular weight of 484.59 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55672885 |
| Molecular Formula | C26H24N6O2S |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)Nc1ccc(CC(=O)N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C26H24N6O2S/c33-23(10-11-24-30-21-4-1-2-5-22(21)35-24)29-20-8-6-19(7-9-20)18-25(34)31-14-16-32(17-15-31)26-27-12-3-13-28-26/h1-13H,14-18H2,(H,29,33)/b11-10+ |
| InChIKey | UBAJPLJTFRCZCO-ZHACJKMWSA-N |
| XLogP | 3.63 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|