C17H11F3N2O2S — CID 7957144
(E)-3-(1,3-benzothiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 7957144) has the molecular formula C17H11F3N2O2S and a molecular weight of 364.35 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 7957144 |
| Molecular Formula | C17H11F3N2O2S |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[4-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H11F3N2O2S/c18-17(19,20)24-12-7-5-11(6-8-12)21-15(23)9-10-16-22-13-3-1-2-4-14(13)25-16/h1-10H,(H,21,23)/b10-9+ |
| InChIKey | FJSCGTYAVXJUTD-MDZDMXLPSA-N |
| XLogP | 4.85 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|