C21H18F3N3O2S — CID 55671490
(E)-3-(1,3-benzothiazol-2-yl)-N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]prop-2-enamide (PubChem CID 55671490) has the molecular formula C21H18F3N3O2S and a molecular weight of 433.46 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55671490 |
| Molecular Formula | C21H18F3N3O2S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[3-[[ethyl-(2,2,2-trifluoroacetyl)amino]methyl]phenyl]prop-2-enamide |
| SMILES | CCN(Cc1cccc(NC(=O)/C=C/c2nc3ccccc3s2)c1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C21H18F3N3O2S/c1-2-27(20(29)21(22,23)24)13-14-6-5-7-15(12-14)25-18(28)10-11-19-26-16-8-3-4-9-17(16)30-19/h3-12H,2,13H2,1H3,(H,25,28)/b11-10+ |
| InChIKey | VGALSPNPPSRQAG-ZHACJKMWSA-N |
| XLogP | 4.86 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|