C18H20FN2O2+ — CID 6949966
3-fluoro-N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]benzamide (PubChem CID 6949966) has the molecular formula C18H20FN2O2+ and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-fluoro-N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]benzamide.
| Compound Name | 3-fluoro-N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 6949966 |
| Molecular Formula | C18H20FN2O2+ |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-fluoro-N-[4-(morpholin-4-ium-4-ylmethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C[NH+]2CCOCC2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C18H19FN2O2/c19-16-3-1-2-15(12-16)18(22)20-17-6-4-14(5-7-17)13-21-8-10-23-11-9-21/h1-7,12H,8-11,13H2,(H,20,22)/p+1 |
| InChIKey | CIPVTEGHZRBICN-UHFFFAOYSA-O |
| XLogP | 1.49 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |