C19H21F2N2O3+ — CID 9046550
N-[4-(difluoromethoxy)phenyl]-4-(morpholin-4-ium-4-ylmethyl)benzamide (PubChem CID 9046550) has the molecular formula C19H21F2N2O3+ and a molecular weight of 363.38 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-4-(morpholin-4-ium-4-ylmethyl)benzamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-4-(morpholin-4-ium-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 9046550 |
| Molecular Formula | C19H21F2N2O3+ |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-4-(morpholin-4-ium-4-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(OC(F)F)cc1)c1ccc(C[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C19H20F2N2O3/c20-19(21)26-17-7-5-16(6-8-17)22-18(24)15-3-1-14(2-4-15)13-23-9-11-25-12-10-23/h1-8,19H,9-13H2,(H,22,24)/p+1 |
| InChIKey | OSSBAOAYUPMBLO-UHFFFAOYSA-O |
| XLogP | 1.96 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |