C15H12FNO3 — CID 16792926
2-[4-[(3-fluorobenzoyl)amino]phenyl]acetic acid (PubChem CID 16792926) has the molecular formula C15H12FNO3 and a molecular weight of 273.26 g/mol. Its IUPAC name is 2-[4-[(3-fluorobenzoyl)amino]phenyl]acetic acid.
| Compound Name | 2-[4-[(3-fluorobenzoyl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 16792926 |
| Molecular Formula | C15H12FNO3 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-[4-[(3-fluorobenzoyl)amino]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NC(=O)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C15H12FNO3/c16-12-3-1-2-11(9-12)15(20)17-13-6-4-10(5-7-13)8-14(18)19/h1-7,9H,8H2,(H,17,20)(H,18,19) |
| InChIKey | RTIMUSDVQJVDOI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |