C25H26BrN2O3+ — CID 4748638
4-[(4-bromophenoxy)methyl]-N-[3-(morpholin-4-ium-4-ylmethyl)phenyl]benzamide (PubChem CID 4748638) has the molecular formula C25H26BrN2O3+ and a molecular weight of 482.40 g/mol. Its IUPAC name is 4-[(4-bromophenoxy)methyl]-N-[3-(morpholin-4-ium-4-ylmethyl)phenyl]benzamide.
| Compound Name | 4-[(4-bromophenoxy)methyl]-N-[3-(morpholin-4-ium-4-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 4748638 |
| Molecular Formula | C25H26BrN2O3+ |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 4-[(4-bromophenoxy)methyl]-N-[3-(morpholin-4-ium-4-ylmethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C[NH+]2CCOCC2)c1)c1ccc(COc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C25H25BrN2O3/c26-22-8-10-24(11-9-22)31-18-19-4-6-21(7-5-19)25(29)27-23-3-1-2-20(16-23)17-28-12-14-30-15-13-28/h1-11,16H,12-15,17-18H2,(H,27,29)/p+1 |
| InChIKey | KPVZAKSYRGQHBY-UHFFFAOYSA-O |
| XLogP | 3.70 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |