C21H18BrNO5S — CID 175601981
4-[(4-bromophenoxy)methyl]-N-(4-hydroxy-3-methylsulfonylphenyl)benzamide (PubChem CID 175601981) has the molecular formula C21H18BrNO5S and a molecular weight of 476.35 g/mol. Its IUPAC name is 4-[(4-bromophenoxy)methyl]-N-(4-hydroxy-3-methylsulfonylphenyl)benzamide.
| Compound Name | 4-[(4-bromophenoxy)methyl]-N-(4-hydroxy-3-methylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 175601981 |
| Molecular Formula | C21H18BrNO5S |
| Molecular Weight | 476.35 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | 4-[(4-bromophenoxy)methyl]-N-(4-hydroxy-3-methylsulfonylphenyl)benzamide |
| SMILES | CS(=O)(=O)c1cc(NC(=O)c2ccc(COc3ccc(Br)cc3)cc2)ccc1O |
| InChI | InChI=1S/C21H18BrNO5S/c1-29(26,27)20-12-17(8-11-19(20)24)23-21(25)15-4-2-14(3-5-15)13-28-18-9-6-16(22)7-10-18/h2-12,24H,13H2,1H3,(H,23,25) |
| InChIKey | PFLVLXFCLZMANV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|