C23H20F3NO6S — CID 175987914
N-(4-hydroxy-3-methylsulfonylphenyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethoxy]benzamide (PubChem CID 175987914) has the molecular formula C23H20F3NO6S and a molecular weight of 495.48 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfonylphenyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethoxy]benzamide.
| Compound Name | N-(4-hydroxy-3-methylsulfonylphenyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethoxy]benzamide |
|---|---|
| PubChem CID | 175987914 |
| Molecular Formula | C23H20F3NO6S |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfonylphenyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethoxy]benzamide |
| SMILES | CS(=O)(=O)c1cc(NC(=O)c2ccc(OCCc3ccc(OC(F)(F)F)cc3)cc2)ccc1O |
| InChI | InChI=1S/C23H20F3NO6S/c1-34(30,31)21-14-17(6-11-20(21)28)27-22(29)16-4-9-18(10-5-16)32-13-12-15-2-7-19(8-3-15)33-23(24,25)26/h2-11,14,28H,12-13H2,1H3,(H,27,29) |
| InChIKey | IAOFMXLDRDFIOM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|