C19H23N3O4S — CID 175602078
N-(4-hydroxy-3-methylsulfonylphenyl)-4-(piperazin-1-ylmethyl)benzamide (PubChem CID 175602078) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfonylphenyl)-4-(piperazin-1-ylmethyl)benzamide.
| Compound Name | N-(4-hydroxy-3-methylsulfonylphenyl)-4-(piperazin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 175602078 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfonylphenyl)-4-(piperazin-1-ylmethyl)benzamide |
| SMILES | CS(=O)(=O)c1cc(NC(=O)c2ccc(CN3CCNCC3)cc2)ccc1O |
| InChI | InChI=1S/C19H23N3O4S/c1-27(25,26)18-12-16(6-7-17(18)23)21-19(24)15-4-2-14(3-5-15)13-22-10-8-20-9-11-22/h2-7,12,20,23H,8-11,13H2,1H3,(H,21,24) |
| InChIKey | FQEWRYHAWOKTLX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|