C23H19F4NO7S2 — CID 175601998
3-fluoro-N-(4-hydroxy-3-methylsulfonylphenyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethylsulfonyl]benzamide (PubChem CID 175601998) has the molecular formula C23H19F4NO7S2 and a molecular weight of 561.53 g/mol. Its IUPAC name is 3-fluoro-N-(4-hydroxy-3-methylsulfonylphenyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethylsulfonyl]benzamide.
| Compound Name | 3-fluoro-N-(4-hydroxy-3-methylsulfonylphenyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethylsulfonyl]benzamide |
|---|---|
| PubChem CID | 175601998 |
| Molecular Formula | C23H19F4NO7S2 |
| Molecular Weight | 561.53 g/mol |
| Exact Mass | 561.05 |
| IUPAC Name | 3-fluoro-N-(4-hydroxy-3-methylsulfonylphenyl)-4-[2-[4-(trifluoromethoxy)phenyl]ethylsulfonyl]benzamide |
| SMILES | CS(=O)(=O)c1cc(NC(=O)c2ccc(S(=O)(=O)CCc3ccc(OC(F)(F)F)cc3)c(F)c2)ccc1O |
| InChI | InChI=1S/C23H19F4NO7S2/c1-36(31,32)21-13-16(5-8-19(21)29)28-22(30)15-4-9-20(18(24)12-15)37(33,34)11-10-14-2-6-17(7-3-14)35-23(25,26)27/h2-9,12-13,29H,10-11H2,1H3,(H,28,30) |
| InChIKey | PFLOGUCAPSNJLJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|