C24H26N2O4S — CID 17308519
N-(3,5-dimethylphenyl)-4-[[4-(dimethylsulfamoyl)phenyl]methoxy]benzamide (PubChem CID 17308519) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-4-[[4-(dimethylsulfamoyl)phenyl]methoxy]benzamide.
| Compound Name | N-(3,5-dimethylphenyl)-4-[[4-(dimethylsulfamoyl)phenyl]methoxy]benzamide |
|---|---|
| PubChem CID | 17308519 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-(3,5-dimethylphenyl)-4-[[4-(dimethylsulfamoyl)phenyl]methoxy]benzamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2ccc(OCc3ccc(S(=O)(=O)N(C)C)cc3)cc2)c1 |
| InChI | InChI=1S/C24H26N2O4S/c1-17-13-18(2)15-21(14-17)25-24(27)20-7-9-22(10-8-20)30-16-19-5-11-23(12-6-19)31(28,29)26(3)4/h5-15H,16H2,1-4H3,(H,25,27) |
| InChIKey | OTQNOCMDRVCEPP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |