C24H19FN2O5S — CID 175601979
N-(2-fluoro-4-hydroxy-5-methylsulfonylphenyl)-4-(isoquinolin-6-yloxymethyl)benzamide (PubChem CID 175601979) has the molecular formula C24H19FN2O5S and a molecular weight of 466.49 g/mol. Its IUPAC name is N-(2-fluoro-4-hydroxy-5-methylsulfonylphenyl)-4-(isoquinolin-6-yloxymethyl)benzamide.
| Compound Name | N-(2-fluoro-4-hydroxy-5-methylsulfonylphenyl)-4-(isoquinolin-6-yloxymethyl)benzamide |
|---|---|
| PubChem CID | 175601979 |
| Molecular Formula | C24H19FN2O5S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | N-(2-fluoro-4-hydroxy-5-methylsulfonylphenyl)-4-(isoquinolin-6-yloxymethyl)benzamide |
| SMILES | CS(=O)(=O)c1cc(NC(=O)c2ccc(COc3ccc4cnccc4c3)cc2)c(F)cc1O |
| InChI | InChI=1S/C24H19FN2O5S/c1-33(30,31)23-12-21(20(25)11-22(23)28)27-24(29)16-4-2-15(3-5-16)14-32-19-7-6-18-13-26-9-8-17(18)10-19/h2-13,28H,14H2,1H3,(H,27,29) |
| InChIKey | YDZNEVBHQPNDQJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|